70928-91-5 Usage
Uses
Used in Pharmaceutical Industry:
4-Propylcyclohexanecarboxylic acid is used as a starting material for the synthesis of various biologically active molecules and pharmaceuticals. Its versatile reactivity and functional group tolerance make it suitable for the development of new drugs with potential therapeutic applications.
Used in Chemical Industry:
4-Propylcyclohexanecarboxylic acid is used as a building block in the synthesis of various chemical compounds and materials. Its unique structure and properties contribute to the development of innovative products in the chemical industry.
Used in Organic Synthesis:
4-Propylcyclohexanecarboxylic acid is used as a chiral building block in organic synthesis. Its potential for asymmetric reactions and the formation of enantiomerically pure compounds makes it a valuable component in the synthesis of complex organic molecules with specific biological activities.
Research and Development:
The use of 4-Propylcyclohexanecarboxylic acid continues to be researched and explored in the development of new drugs and materials. Its unique properties and reactivity offer opportunities for the discovery of novel therapeutic agents and innovative chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 70928-91-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,9,2 and 8 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 70928-91:
(7*7)+(6*0)+(5*9)+(4*2)+(3*8)+(2*9)+(1*1)=145
145 % 10 = 5
So 70928-91-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H18O2/c1-2-3-8-4-6-9(7-5-8)10(11)12/h8-9H,2-7H2,1H3,(H,11,12)
70928-91-5Relevant academic research and scientific papers
Epimerization of 2- or 4- substituted cyclohexanecarboxylic acids
-
, (2008/06/13)
The present invention relates to a new method for obtaining a purity of about 93% to 100% of the trans form of 2- or 4-substituted cyclohexanecarboxylic acid or reactive derivatives thereof from the cis form or a mixture of the cis and trans forms by a single step, particularly, to a method for obtaining a purity of substantially 100% of the trans form of 4-substituted cyclohexanecarboxylic acid.
