7093-41-6 Usage
General Description
3,9-diethoxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane is a complex chemical compound that contains both oxygen and phosphorus atoms in its spirocyclic structure. It is a white solid that is insoluble in water and has limited solubility in organic solvents. 3,9-diethoxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane has potential applications in the field of pharmaceuticals, as it may have biological activity due to its unique structural features. Additionally, it can be used as a reagent in organic synthesis and serve as a building block for the construction of more complex chemical structures. However, due to its complex nature and potential reactivity, proper handling and precautions are necessary when working with this chemical.
Check Digit Verification of cas no
The CAS Registry Mumber 7093-41-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,0,9 and 3 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 7093-41:
(6*7)+(5*0)+(4*9)+(3*3)+(2*4)+(1*1)=96
96 % 10 = 6
So 7093-41-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H18O6P2/c1-3-10-16-12-5-9(6-13-16)7-14-17(11-4-2)15-8-9/h3-8H2,1-2H3
