710311-03-8 Usage
General Description
Benzoic acid, 4-[(3,5-dimethoxybenzoyl)amino]-2-hydroxy-, is a chemical compound with a complex molecular structure. It includes a benzoic acid moiety, which is itself comprised of a benzene ring attached to a carboxylic acid group, substituted with an amino group that is further modified by another benzoyl group that features two methoxy groups. It also features a hydroxyl group, which is a combination of oxygen and hydrogen atoms. This chemical is likely to exhibit unique properties and reactivity due to its various functional groups and complex structure. The detailed properties such as physical state, color, melting point, boiling point, solubility, and specific activities of this compound may vary and can be usually found in scientific databases or literature.
Check Digit Verification of cas no
The CAS Registry Mumber 710311-03-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,1,0,3,1 and 1 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 710311-03:
(8*7)+(7*1)+(6*0)+(5*3)+(4*1)+(3*1)+(2*0)+(1*3)=88
88 % 10 = 8
So 710311-03-8 is a valid CAS Registry Number.
InChI:InChI=1/C16H15NO6/c1-22-11-5-9(6-12(8-11)23-2)15(19)17-10-3-4-13(16(20)21)14(18)7-10/h3-8,18H,1-2H3,(H,17,19)(H,20,21)
