71033-00-6 Usage
Structure
Consists of a terephthalic acid core with an aniline group (anilino) and a bromine atom attached at specific positions.
Utility
Commonly used in organic chemistry for synthesizing various materials and drugs.
Biological Properties
May exhibit interesting biological properties due to its structure.
Physical Properties
Varied physical properties contribute to its versatility.
Applications
Valuable as a building block for developing new materials and pharmaceutical drugs.
Industry Relevance
Significant in pharmaceuticals, materials science, and organic synthesis research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 71033-00-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,0,3 and 3 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 71033-00:
(7*7)+(6*1)+(5*0)+(4*3)+(3*3)+(2*0)+(1*0)=76
76 % 10 = 6
So 71033-00-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H10BrNO4/c15-11-6-10(14(19)20)12(7-9(11)13(17)18)16-8-4-2-1-3-5-8/h1-7,16H,(H,17,18)(H,19,20)
