71035-06-8 Usage
General Description
The chemical (1S)-1α-(β-D-Glucopyranosyloxy)-1,4aα,5,6,7,7aα-hexahydro-5-oxocyclopenta[c]pyran-4,7α-dicarboxylic acid dimethyl ester is a complex molecule that consists of a cyclopentane ring with two carboxylic acid groups. It also contains a glucopyranosyl group attached to the first carbon atom and two methyl ester groups. (1S)-1α-(β-D-Glucopyranosyloxy)-1,4aα,5,6,7,7aα-hexahydro-5-oxocyclopenta[c]pyran-4,7α-dicarboxylic acid dimethyl ester exhibits potential biological activity and may have applications in pharmaceutical research or drug development. Due to its intricate structure and potential therapeutic properties, it is of interest to scientists and researchers in the field of organic chemistry and medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 71035-06-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,0,3 and 5 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 71035-06:
(7*7)+(6*1)+(5*0)+(4*3)+(3*5)+(2*0)+(1*6)=88
88 % 10 = 8
So 71035-06-8 is a valid CAS Registry Number.
InChI:InChI=1/C18H24O12/c1-26-15(24)6-3-8(20)10-7(16(25)27-2)5-28-17(11(6)10)30-18-14(23)13(22)12(21)9(4-19)29-18/h5-6,9-14,17-19,21-23H,3-4H2,1-2H3/t6-,9-,10-,11+,12-,13+,14-,17-,18+/m1/s1