71039-95-7 Usage
Uses
Used in Pharmaceutical Applications:
[1-(4-methoxybenzoyl)-5-oxo-2H-pyrrol-3-yl] acetate is used as a potential pharmaceutical agent for its unique structure and properties. [1-(4-methoxybenzoyl)-5-oxo-2H-pyrrol-3-yl] acetate's ability to interact with biological targets and its potential for modification and optimization make it a promising candidate for the development of new drugs and therapies.
Used in Industrial Applications:
In the industrial sector, [1-(4-methoxybenzoyl)-5-oxo-2H-pyrrol-3-yl] acetate may be utilized as a building block or intermediate in the synthesis of various chemical products. Its unique structure could be exploited to create novel materials with specific properties, such as improved stability, reactivity, or selectivity, which could be beneficial in various industrial processes.
Used in Research and Development:
[1-(4-methoxybenzoyl)-5-oxo-2H-pyrrol-3-yl] acetate is used as a subject of study in the fields of organic chemistry, medicinal chemistry, and materials science. Its synthesis and characterization can provide valuable insights into the properties and potential applications of [1-(4-methoxybenzoyl)-5-oxo-2H-pyrrol-3-yl] acetate, as well as contribute to the broader understanding of chemical structures and their relationships to function.
Used in Organic Chemistry:
As a derivative of pyrrole and acetate, [1-(4-methoxybenzoyl)-5-oxo-2H-pyrrol-3-yl] acetate is used as a compound of interest in organic chemistry. Its unique structure offers opportunities for further functionalization and modification, potentially leading to the development of new organic compounds with diverse applications.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, [1-(4-methoxybenzoyl)-5-oxo-2H-pyrrol-3-yl] acetate is used as a starting point for the design and synthesis of new pharmaceutical agents. Its unique structure and properties may enable the development of novel drugs with improved efficacy, selectivity, and safety profiles.
Used in Materials Science:
[1-(4-methoxybenzoyl)-5-oxo-2H-pyrrol-3-yl] acetate is used as a potential component in the development of new materials with specific properties. Its unique molecular structure could contribute to the creation of materials with enhanced performance characteristics, such as improved mechanical strength, thermal stability, or chemical resistance, which could be valuable in various applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 71039-95-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,0,3 and 9 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 71039-95:
(7*7)+(6*1)+(5*0)+(4*3)+(3*9)+(2*9)+(1*5)=117
117 % 10 = 7
So 71039-95-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H13NO5/c1-9(16)20-12-7-13(17)15(8-12)14(18)10-3-5-11(19-2)6-4-10/h3-7H,8H2,1-2H3
