71160-32-2 Usage
Uses
Used in Pharmaceutical Applications:
2-(2,4-bisnitrophenylsulfanyl)-4-methylpyrimidine is used as a pharmaceutical agent for its potential antimicrobial and anticancer properties. 2-(2,4-bisnitrophenylsulfanyl)-4-methylpyrimidine's unique structure, including the nitro groups and sulfur atom, may contribute to its effectiveness against various pathogens and cancer cells by interacting with specific biological targets.
Used in Research Applications:
In the field of research, 2-(2,4-bisnitrophenylsulfanyl)-4-methylpyrimidine serves as a valuable tool for studying the mechanisms of action and potential therapeutic applications of compounds with similar structures. Its biological activities and interactions with biological targets can provide insights into the development of new drugs and therapeutic strategies.
Used in Drug Discovery:
2-(2,4-bisnitrophenylsulfanyl)-4-methylpyrimidine is utilized in drug discovery processes to identify and optimize compounds with desired biological activities. Its unique structural features and potential bioactivity make it a promising candidate for further investigation and development as a therapeutic agent.
Used in Medicinal Chemistry:
In medicinal chemistry, 2-(2,4-bisnitrophenylsulfanyl)-4-methylpyrimidine is employed as a starting point for the synthesis of novel compounds with improved biological properties. Its structural features can be modified to explore the structure-activity relationship and optimize the compound's therapeutic potential.
Overall, 2-(2,4-bisnitrophenylsulfanyl)-4-methylpyrimidine is a versatile compound with a wide range of applications in various industries, including pharmaceuticals, research, drug discovery, and medicinal chemistry. Its unique structure and potential biological activities make it a valuable asset in the development of new therapeutic agents and the advancement of scientific knowledge.
Check Digit Verification of cas no
The CAS Registry Mumber 71160-32-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,1,6 and 0 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 71160-32:
(7*7)+(6*1)+(5*1)+(4*6)+(3*0)+(2*3)+(1*2)=92
92 % 10 = 2
So 71160-32-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H8N4O4S/c1-7-4-5-12-11(13-7)20-10-3-2-8(14(16)17)6-9(10)15(18)19/h2-6H,1H3
