71310-81-1 Usage
General Description
1,1-dihomo-8-ketoprostaglandin F1alpha, also known as 1,1-DH-PGF1alpha, is a chemical compound derived from the metabolism of arachidonic acid and is a member of the prostaglandin family. It is a potent vasodilator, meaning it can relax and widen blood vessels, leading to increased blood flow and reduced blood pressure. 1,1-dihomo-8-ketoprostaglandin F1alpha also exhibits anti-inflammatory and anti-thrombotic properties, making it potentially useful in the treatment of cardiovascular diseases and other inflammatory conditions. Additionally, 1,1-DH-PGF1alpha has been investigated for its potential role in protecting against oxidative stress and reducing the risk of certain complications of diabetes. Overall, the compound has shown promise as a therapeutic target for various cardiovascular and inflammatory disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 71310-81-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,3,1 and 0 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 71310-81:
(7*7)+(6*1)+(5*3)+(4*1)+(3*0)+(2*8)+(1*1)=91
91 % 10 = 1
So 71310-81-1 is a valid CAS Registry Number.
InChI:InChI=1/C22H38O6/c1-2-3-11-18(23)19(24)14-13-17-16(20(25)15-21(17)26)10-8-6-4-5-7-9-12-22(27)28/h13-14,16-17,19-21,24-26H,2-12,15H2,1H3,(H,27,28)/b14-13+/t16-,17-,19+,20+,21-/m1/s1