71337-53-6 Usage
General Description
BIS(3,5-DIBROMOSALICYL) FUMARATE is a chemical compound with the molecular formula C14H6Br4O6. It is a fumaric acid derivative that contains two 3,5-dibromosalicyl groups. BIS(3,5-DIBROMOSALICYL) FUMARATE is often used as a flame retardant in various materials, including plastics, textiles, and electronics. It acts by releasing bromine radicals when exposed to high temperatures, which then react with and inhibit the combustion process. BIS(3,5-DIBROMOSALICYL) FUMARATE is also known for its ability to inhibit the growth of certain microorganisms, making it useful in antimicrobial applications. Additionally, it has been studied for its potential use in pharmaceuticals, particularly as an antifungal agent. However, BIS(3,5-DIBROMOSALICYL) FUMARATE should be handled and used with caution due to its potential environmental and health risks associated with brominated compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 71337-53-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,3,3 and 7 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 71337-53:
(7*7)+(6*1)+(5*3)+(4*3)+(3*7)+(2*5)+(1*3)=116
116 % 10 = 6
So 71337-53-6 is a valid CAS Registry Number.
InChI:InChI=1/C18H8Br4O8/c19-7-3-9(17(25)26)15(11(21)5-7)29-13(23)1-2-14(24)30-16-10(18(27)28)4-8(20)6-12(16)22/h1-6H,(H,25,26)(H,27,28)/b2-1+