71412-22-1 Usage
Uses
Used in Pharmaceutical Industry:
2,3-dihydro-4-quinolone hydrochloride is used as a building block for the synthesis of various pharmaceutical compounds. Its unique structure allows for the creation of new drugs with potential therapeutic applications.
Used in Medicinal Chemistry:
2,3-dihydro-4-quinolone hydrochloride is used as a key intermediate in the development of new medications. Its presence in the molecular structure can contribute to the drug's efficacy, stability, and bioavailability.
Used in Biochemistry Research:
2,3-dihydro-4-quinolone hydrochloride is used as a research tool in biochemistry to study the interactions of various biomolecules. Its properties can help in understanding the mechanisms of action of certain biological processes.
Used in Drug Design:
2,3-dihydro-4-quinolone hydrochloride is used as a template in the design of new drugs. Its structure can be modified to create compounds with specific therapeutic targets, potentially leading to the development of novel treatments for various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 71412-22-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,4,1 and 2 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 71412-22:
(7*7)+(6*1)+(5*4)+(4*1)+(3*2)+(2*2)+(1*2)=91
91 % 10 = 1
So 71412-22-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H9NO.ClH/c11-9-5-6-10-8-4-2-1-3-7(8)9;/h1-4,10H,5-6H2;1H
