71412-23-2 Usage
Uses
Used in Organic Synthesis:
3-(aminomethyl)pyrocatechol is used as a building block for the synthesis of various organic compounds due to its functional groups and reactivity. Its versatility in forming different chemical bonds makes it a valuable component in creating a wide range of organic molecules.
Used in Medicinal Chemistry:
In the pharmaceutical industry, 3-(aminomethyl)pyrocatechol is used as a starting material for the development of pharmaceuticals and biologically active molecules. Its unique structure allows for the design of new drugs with potential therapeutic effects, contributing to drug discovery and the advancement of medicine.
Used in Materials Science:
3-(aminomethyl)pyrocatechol's potential applications extend to materials science, where its chemical properties can be harnessed to develop new materials with specific characteristics. Further research into its properties could lead to its use in creating innovative materials for various applications.
Overall, 3-(aminomethyl)pyrocatechol's unique structure and reactivity position it as a valuable compound in multiple fields, with potential for further exploration and development in organic synthesis, medicinal chemistry, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 71412-23-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,4,1 and 2 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 71412-23:
(7*7)+(6*1)+(5*4)+(4*1)+(3*2)+(2*2)+(1*3)=92
92 % 10 = 2
So 71412-23-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H9NO2/c8-4-5-2-1-3-6(9)7(5)10/h1-3,9-10H,4,8H2
