7143-82-0 Usage
Uses
Used in Pharmaceutical Industry:
6-METHYL-2,3-DIHYDROPYRIDAZIN-3-ONE HYDRATE is used as a key intermediate in the synthesis of pharmaceuticals for its potential applications in medicinal chemistry and drug discovery. Its unique structure and properties make it a valuable component in the development of new drugs and therapeutic agents.
Used in Organic Compound Synthesis:
6-METHYL-2,3-DIHYDROPYRIDAZIN-3-ONE HYDRATE is used as a building block in the synthesis of various organic compounds. Its versatility in chemical reactions allows it to be incorporated into a wide range of molecules, contributing to the advancement of organic chemistry and the creation of new materials and compounds.
Used in Research and Development:
6-METHYL-2,3-DIHYDROPYRIDAZIN-3-ONE HYDRATE is utilized in research and development settings to explore its potential applications and properties. Scientists and researchers use 6-METHYL-2,3-DIHYDROPYRIDAZIN-3-ONE HYDRATE to investigate its reactivity, stability, and interactions with other molecules, which can lead to the discovery of new chemical reactions and applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 7143-82-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,1,4 and 3 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 7143-82:
(6*7)+(5*1)+(4*4)+(3*3)+(2*8)+(1*2)=90
90 % 10 = 0
So 7143-82-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H6N2O.H2O/c1-4-2-3-5(8)7-6-4;/h2-3H,1H3,(H,7,8);1H2
