7146-44-3 Usage
Uses
Used in Pharmaceutical Research:
[(4-ethyl-2,5-dioxo-imidazolidin-4-yl)methylideneamino]thiourea is used as a reagent in pharmaceutical research for its potential pharmacological properties and diverse reactivity. It is being studied for its potential as an antimicrobial, antifungal, and anti-inflammatory agent.
Used in Organic Synthesis:
In the field of organic synthesis, [(4-ethyl-2,5-dioxo-imidazolidin-4-yl)methylideneamino]thiourea is used as a reagent due to its complex molecular structure and diverse reactivity, which allows for the creation of various compounds with different applications.
Used in Antimicrobial Applications:
[(4-ethyl-2,5-dioxo-imidazolidin-4-yl)methylideneamino]thiourea is used as an antimicrobial agent for its potential to combat various types of bacteria and other microorganisms, contributing to the development of new treatments and preventive measures against infections.
Used in Antifungal Applications:
[(4-ethyl-2,5-dioxo-imidazolidin-4-yl)methylideneamino]thiourea is also used as an antifungal agent, showcasing its potential to inhibit the growth and proliferation of fungi, which can be beneficial in the development of new antifungal medications and treatments.
Used in Anti-inflammatory Applications:
[(4-ethyl-2,5-dioxo-imidazolidin-4-yl)methylideneamino]thiourea is used as an anti-inflammatory agent, potentially helping to reduce inflammation and alleviate symptoms associated with various inflammatory conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 7146-44-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,1,4 and 6 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 7146-44:
(6*7)+(5*1)+(4*4)+(3*6)+(2*4)+(1*4)=93
93 % 10 = 3
So 7146-44-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H11N5O2S/c1-2-7(3-9-12-5(8)15)4(13)10-6(14)11-7/h3H,2H2,1H3,(H3,8,12,15)(H2,10,11,13,14)/b9-3+