71463-71-3 Usage
Uses
Used in Pharmaceutical Synthesis:
2,3,4,6-Tetraiodobenzoic acid is used as a key intermediate in the synthesis of pharmaceuticals for its ability to introduce iodine atoms into molecular structures, which can enhance the therapeutic properties of certain drugs.
Used in Dye Production:
In the dye industry, 2,3,4,6-Tetraiodobenzoic acid serves as a precursor for the production of dyes, capitalizing on its chemical reactivity and the unique coloration properties imparted by the iodine atoms.
Used in Organic Electronic Materials:
2,3,4,6-Tetraiodobenzoic acid is utilized in the development of organic electronic materials, such as in the creation of organic semiconductors and other components for electronic devices, due to its electronic properties and structural characteristics.
Used as a Reagent in Organic Chemistry:
2,3,4,6-Tetraiodobenzoic acid is employed as a reagent in various organic chemistry reactions, particularly for the introduction of iodine atoms into molecules, facilitating the synthesis of complex organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 71463-71-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,4,6 and 3 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 71463-71:
(7*7)+(6*1)+(5*4)+(4*6)+(3*3)+(2*7)+(1*1)=123
123 % 10 = 3
So 71463-71-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H2I4O2/c8-2-1-3(9)5(10)6(11)4(2)7(12)13/h1H,(H,12,13)
