7148-14-3 Usage
Uses
Used in Pharmaceutical Industry:
[(2S,3S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]oct-2-yl]methyl benzoate is used as a chiral building block for the synthesis of various drugs and biologically active compounds. Its unique structure and functional groups make it a valuable component in the development of new pharmaceuticals.
Used in Medicinal Chemistry and Drug Discovery:
[(2S,3S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]oct-2-yl]methyl benzoat e is also utilized in the field of medicinal chemistry and drug discovery, where it can contribute to the design and synthesis of novel therapeutic agents. Its potential applications in this area are still being explored, but its unique properties make it a promising candidate for further research and development.
Used in Chemical Research:
[(2S,3S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]oct-2-yl]methyl benzoate may also be used in chemical research to study the properties and reactivity of esters, as well as to investigate the potential for new reactions and applications in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 7148-14-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,1,4 and 8 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 7148-14:
(6*7)+(5*1)+(4*4)+(3*8)+(2*1)+(1*4)=93
93 % 10 = 3
So 7148-14-3 is a valid CAS Registry Number.
InChI:InChI=1/C16H21NO3/c1-17-12-7-8-14(17)13(15(18)9-12)10-20-16(19)11-5-3-2-4-6-11/h2-6,12-15,18H,7-10H2,1H3/t12?,13-,14?,15+/m1/s1
