71501-30-9 Usage
Uses
Used in Pharmaceutical Synthesis:
3-amino-2-chloro-3-oxopropionic acid is used as a key intermediate in the synthesis of various pharmaceuticals for its unique chemical properties, contributing to the development of new drugs and therapeutic agents.
Used in Organic Chemistry as a Reagent:
In the field of organic chemistry, 3-amino-2-chloro-3-oxopropionic acid serves as a valuable reagent, facilitating specific chemical reactions and transformations that are essential for the advancement of chemical research and product development.
Used in Research and Development:
3-amino-2-chloro-3-oxopropionic acid is utilized in research and development settings to explore its chemical properties and potential applications, including its reactivity and behavior in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 71501-30-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,5,0 and 1 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 71501-30:
(7*7)+(6*1)+(5*5)+(4*0)+(3*1)+(2*3)+(1*0)=89
89 % 10 = 9
So 71501-30-9 is a valid CAS Registry Number.
InChI:InChI=1/C3H4ClNO3/c4-1(2(5)6)3(7)8/h1H,(H2,5,6)(H,7,8)
