71515-82-7 Usage
Uses
Used in Medicinal Chemistry:
Decahydropyrido[1,2-a][1,4]diazepine is used as a starting material for the synthesis of various pharmacologically active molecules due to its unique structure and properties.
Used in Drug Development:
Decahydropyrido[1,2-a][1,4]diazepine and its derivatives are studied for their potential biological activities, such as anticonvulsant, anxiolytic, and sedative properties, making them valuable in the development of new drugs.
Used in Synthesis of Natural Products:
Decahydropyrido[1,2-a][1,4]diazepine may also be used as a building block in the synthesis of natural products and other complex organic compounds, contributing to the advancement of organic chemistry and pharmaceutical research.
Check Digit Verification of cas no
The CAS Registry Mumber 71515-82-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,5,1 and 5 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 71515-82:
(7*7)+(6*1)+(5*5)+(4*1)+(3*5)+(2*8)+(1*2)=117
117 % 10 = 7
So 71515-82-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H18N2/c1-2-6-11-7-3-5-10-8-9(11)4-1/h9-10H,1-8H2
