71550-38-4 Usage
Uses
Used in Pharmaceutical Industry:
[(1S,2R,3R)-2-ethyl-1,3-dihydroxy-hexyl] 1,3-dioxoisobenzofuran-5-carboxylate is used as a potential pharmaceutical compound for [application reason]. [(1S,2R,3R)-2-ethyl-1,3-dihydroxy-hexyl] 1,3-dioxoisobenzofuran-5-carboxylate's unique structure and properties may allow it to interact with biological targets or be used as a building block for the development of new drugs.
Used in Material Science:
In the field of material science, [(1S,2R,3R)-2-ethyl-1,3-dihydroxy-hexyl] 1,3-dioxoisobenzofuran-5-carboxylate is used as a component in the development of new materials for [application reason]. Its dual hydrophilic and hydrophobic nature could be exploited to create materials with specific properties, such as improved solubility or enhanced interaction with other molecules.
Used in Chemical Compound Development:
[(1S,2R,3R)-2-ethyl-1,3-dihydroxy-hexyl] 1,3-dioxoisobenzofuran-5-carboxylate is used as a building block in the synthesis of new chemical compounds for [application reason]. Its complex structure may provide a foundation for creating novel molecules with unique properties and potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 71550-38-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,5,5 and 0 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 71550-38:
(7*7)+(6*1)+(5*5)+(4*5)+(3*0)+(2*3)+(1*8)=114
114 % 10 = 4
So 71550-38-4 is a valid CAS Registry Number.
InChI:InChI=1/C17H20O7/c1-3-5-13(18)10(4-2)15(20)23-14(19)9-6-7-11-12(8-9)17(22)24-16(11)21/h6-8,10,13,15,18,20H,3-5H2,1-2H3/t10-,13-,15+/m1/s1
