71574-33-9 Usage
Uses
Used in Pharmaceutical Industry:
2-AMINO-4,5-DIMETHYLTHIAZOLE HYDROCHLORIDE is used as an intermediate in the synthesis of various pharmaceutical compounds. Its role in the synthesis process is crucial for the development of new drugs with potential therapeutic applications.
Used in Chemical Synthesis:
In the field of chemical synthesis, 2-AMINO-4,5-DIMETHYLTHIAZOLE HYDROCHLORIDE serves as a key building block for the creation of more complex molecules. Its unique structure allows for further functionalization and modification, leading to the development of novel compounds with specific properties and applications.
Specific Application:
2-AMINO-4,5-DIMETHYLTHIAZOLE HYDROCHLORIDE is used in the synthesis of 2-[3-[3-(piperidinomethyl)phenoxy]propionamido]-4,5-dimethylthiazole. 2-AMINO-4,5-DIMETHYLTHIAZOLE HYDROCHLORIDE may have potential applications in various industries, such as pharmaceuticals, due to its unique chemical structure and properties. The synthesis of 2-AMINO-4,5-DIMETHYLTHIAZOLE HYDROCHLORIDE demonstrates the versatility of 2-AMINO-4,5-DIMETHYLTHIAZOLE HYDROCHLORIDE as a starting material in the development of new and innovative products.
Check Digit Verification of cas no
The CAS Registry Mumber 71574-33-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,5,7 and 4 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 71574-33:
(7*7)+(6*1)+(5*5)+(4*7)+(3*4)+(2*3)+(1*3)=129
129 % 10 = 9
So 71574-33-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H8N2S.ClH/c1-3-4(2)8-5(6)7-3;/h1-2H3,(H2,6,7);1H
