71625-90-6 Usage
Uses
Used in Pharmaceutical Research and Development:
(5-CHLORO-1-BENZOTHIOPHEN-3-YL)METHYLAMINE is used as a key intermediate in the synthesis of various pharmaceutical compounds for its potential therapeutic applications. Its unique structure allows for the creation of new drugs and biologically active molecules that can address a range of health conditions.
Used in Drug Synthesis:
In the pharmaceutical industry, (5-CHLORO-1-BENZOTHIOPHEN-3-YL)METHYLAMINE is utilized as a building block for the development of novel drug candidates. Its reactivity and chemical properties enable the formation of diverse molecular structures with potential medicinal properties.
Used in Biological Research:
(5-CHLORO-1-BENZOTHIOPHEN-3-YL)METHYLAMINE is employed in biological research to study the interactions of (5-CHLORO-1-BENZOTHIOPHEN-3-YL)METHYLAMINE with various biological targets. This research can provide insights into its potential use in the development of new therapeutic agents.
Used in Industrial Applications:
Beyond its pharmaceutical applications, (5-CHLORO-1-BENZOTHIOPHEN-3-YL)METHYLAMINE may also find use in other industries due to its versatile chemistry and reactivity. Its potential applications in these fields are currently under exploration and may include areas such as material science, chemical synthesis, and more.
Check Digit Verification of cas no
The CAS Registry Mumber 71625-90-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,6,2 and 5 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 71625-90:
(7*7)+(6*1)+(5*6)+(4*2)+(3*5)+(2*9)+(1*0)=126
126 % 10 = 6
So 71625-90-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H8ClNS/c10-7-1-2-9-8(3-7)6(4-11)5-12-9/h1-3,5H,4,11H2
