71705-08-3 Usage
Structure
A triazole derivative with a sulfur atom linked to an isopropyl group
Usage
Commonly used in medicinal chemistry and pharmaceutical research as a building block for the synthesis of potential drug candidates
Potential activities
Investigated for its potential antifungal, antibacterial, and antitumor activities
Other potential applications
Studied for its potential as a corrosion inhibitor and as a ligand in coordination chemistry
Physiological and pharmacological properties
Still under investigation, and further research is needed to fully understand its potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 71705-08-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,7,0 and 5 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 71705-08:
(7*7)+(6*1)+(5*7)+(4*0)+(3*5)+(2*0)+(1*8)=113
113 % 10 = 3
So 71705-08-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H9N3S/c1-4(2)9-5-6-3-7-8-5/h3-4H,1-2H3,(H,6,7,8)
