71720-44-0 Usage
Uses
Used in Pharmaceutical Synthesis:
4-(4-METHYLPHENOXY)BUTYL CHLORIDE, 98% is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the creation of new drugs with specific therapeutic properties, contributing to the development of novel treatments for a range of medical conditions.
Used in Agrochemical Production:
In the agrochemical industry, 4-(4-METHYLPHENOXY)BUTYL CHLORIDE, 98% is employed as a crucial component in the production of pesticides and other agricultural chemicals. Its reactivity and stability make it an ideal candidate for the development of effective and long-lasting agrochemicals that protect crops from pests and diseases.
Used in Organic Synthesis:
As an intermediate in organic synthesis, 4-(4-METHYLPHENOXY)BUTYL CHLORIDE, 98% plays a vital role in the preparation of a wide array of organic compounds. Its versatility in chemical reactions enables the synthesis of complex molecules with diverse applications in various industries, including the production of specialty chemicals, dyes, and polymers.
Used in Chemical Compound Manufacturing:
4-(4-METHYLPHENOXY)BUTYL CHLORIDE, 98% is also utilized in the manufacturing of other chemical compounds, further expanding its applications across different sectors. Its high purity and reactivity make it a valuable building block for the creation of new and innovative chemical products that meet the demands of various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 71720-44-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,7,2 and 0 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 71720-44:
(7*7)+(6*1)+(5*7)+(4*2)+(3*0)+(2*4)+(1*4)=110
110 % 10 = 0
So 71720-44-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H15ClO/c1-10-4-6-11(7-5-10)13-9-3-2-8-12/h4-7H,2-3,8-9H2,1H3
