71735-24-5 Usage
Molecular structure
1-[2-(hydroxymethyl)bicyclo[2.2.1]hept-5-en-2-yl]ethan-1-one has a complex molecular structure with a bicyclic ring system and a hydroxymethyl group attached to a bicyclo[2.2.1]hept-5-en-2-yl moiety.
Bicyclic ring system
The compound contains a bicyclic ring system, which is a type of ring structure consisting of two fused rings.
Hydroxymethyl group
A hydroxymethyl group (-CH2OH) is attached to the bicyclo[2.2.1]hept-5-en-2-yl moiety, providing additional functionality and reactivity.
Bicyclo[2
This part of the molecule is a seven-membered ring with two carbon atoms forming a bridge between two of the ring's carbons, resulting in a unique structural arrangement.
Ketone functional group
The compound features a ketone functional group (C=O), which is an important structural element in organic chemistry and can participate in various chemical reactions.
Ethyl side chain
An ethyl side chain (-CH2CH3) is present in the molecule, which can influence the compound's physical and chemical properties.
Ketone derivative
1-[2-(hydroxymethyl)bicyclo[2.2.1]hept-5-en-2-yl]ethan-1-one is a derivative of a ketone, which means it is a compound that has been modified from a ketone structure.
Chemical reactions
The compound is used in various chemical reactions due to its unique structure and functional groups.
Organic synthesis
It is utilized in organic synthesis, which is the process of constructing organic compounds from simpler building blocks.
Diverse applications
The unique structure of 1-[2-(hydroxymethyl)bicyclo[2.2.1]hept-5-en-2-yl]ethan-1-one gives it potential for diverse applications in the field of chemistry and pharmacology.
Check Digit Verification of cas no
The CAS Registry Mumber 71735-24-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,7,3 and 5 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 71735-24:
(7*7)+(6*1)+(5*7)+(4*3)+(3*5)+(2*2)+(1*4)=125
125 % 10 = 5
So 71735-24-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H14O2/c1-7(12)10(6-11)5-8-2-3-9(10)4-8/h2-3,8-9,11H,4-6H2,1H3
