71811-78-4 Usage
Uses
Used in Pharmaceutical Industry:
3-Ethyl-5-(1-ethyl-(1H)-quinolin-4-ylidene)-2-thioxothiazolidin-4-one is used as a potential pharmaceutical agent for its possible interactions with biological systems. Its complex structure may allow it to target specific biological pathways or receptors, offering new avenues for drug development.
Used in Research and Development:
In the field of chemical research, 3-ethyl-5-(1-ethyl-(1H)-quinolin-4-ylidene)-2-thioxothiazolidin-4-one serves as a subject for further investigation to understand its chemical properties, reactivity, and potential applications in various chemical processes or as a precursor for the synthesis of other compounds.
Used in Chemical Synthesis:
3-Ethyl-5-(1-ethyl-(1H)-quinolin-4-ylidene)-2-thioxothiazolidin-4-one may be utilized as an intermediate or building block in the synthesis of more complex organic molecules, particularly in the development of novel pharmaceuticals, agrochemicals, or other specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 71811-78-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,8,1 and 1 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 71811-78:
(7*7)+(6*1)+(5*8)+(4*1)+(3*1)+(2*7)+(1*8)=124
124 % 10 = 4
So 71811-78-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H16N2OS2/c1-3-17-10-9-12(11-7-5-6-8-13(11)17)14-15(19)18(4-2)16(20)21-14/h5-10H,3-4H2,1-2H3/b14-12+
