71839-14-0 Usage
Uses
Used in Research Applications:
2,3-dihydro-2-methyl-9-phenyl-1H-indeno[2,1-c]pyridine hydrobromide is used as a research tool for investigating biological processes and drug development. Its unique chemical structure allows scientists to explore its interactions with various biological targets and pathways, contributing to a better understanding of disease mechanisms and the discovery of novel therapeutic agents.
Used in Pharmaceutical Applications:
In the pharmaceutical industry, 2,3-dihydro-2-methyl-9-phenyl-1H-indeno[2,1-c]pyridine hydrobromide is used as a potential therapeutic agent. Its hydrobromide salt form enhances its solubility in aqueous solutions, making it more suitable for experimental and clinical use. 2,3-dihydro-2-methyl-9-phenyl-1H-indeno[2,1-c]pyridine hydrobromide may have promising properties and potential for the development of new drugs to treat various diseases and conditions.
Overall, 2,3-dihydro-2-methyl-9-phenyl-1H-indeno[2,1-c]pyridine hydrobromide is a versatile chemical compound with applications in both research and pharmaceutical fields. Its unique structure and properties make it a valuable asset for advancing scientific knowledge and developing innovative treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 71839-14-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,8,3 and 9 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 71839-14:
(7*7)+(6*1)+(5*8)+(4*3)+(3*9)+(2*1)+(1*4)=140
140 % 10 = 0
So 71839-14-0 is a valid CAS Registry Number.
InChI:InChI=1/C19H17N.BrH/c1-20-12-11-16-15-9-5-6-10-17(15)19(18(16)13-20)14-7-3-2-4-8-14;/h2-11H,12-13H2,1H3;1H
