71865-30-0 Usage
Uses
Used in Pharmaceutical Industry:
(E)-1,4,5,6-tetrahydro-2-[2-(3-hydroxyphenyl)vinyl]-1-methylpyrimidine-1,3-diylium [R-(R,R)]-tartrate is used as a potential pharmaceutical compound for its possible biological activity and therapeutic effects. (E)-1,4,5,6-tetrahydro-2-[2-(3-hydroxyphenyl)vinyl]-1-methylpyrimidine-1,3-diylium [R-(R,R)]-tartrate's unique structure and stereochemistry may contribute to its efficacy in treating specific medical conditions or diseases, although further research is necessary to confirm these potential applications.
Used in Research and Development:
In the field of chemical research and development, (E)-1,4,5,6-tetrahydro-2-[2-(3-hydroxyphenyl)vinyl]-1-methylpyrimidine-1,3-diylium [R-(R,R)]-tartrate serves as a valuable compound for studying its chemical properties, reactivity, and potential interactions with other molecules. This research could lead to the discovery of new drugs or therapies based on the compound's unique characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 71865-30-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,8,6 and 5 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 71865-30:
(7*7)+(6*1)+(5*8)+(4*6)+(3*5)+(2*3)+(1*0)=140
140 % 10 = 0
So 71865-30-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H13N2O.C4H6O6/c1-15-9-3-8-14-13(15)7-6-11-4-2-5-12(16)10-11;5-1(3(7)8)2(6)4(9)10/h2,4-10H,3H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/q+1;/p-1/b7-6+;/t;1-,2?/m.1/s1
