71865-30-0 Usage
General Description
The chemical compound (E)-1,4,5,6-tetrahydro-2-[2-(3-hydroxyphenyl)vinyl]-1-methylpyrimidine-1,3-diylium [R-(R*,R*)]-tartrate is a tartrate salt of a pyrimidine derivative. It is an organic compound with a complex molecular structure that includes a pyrimidine ring and a hydroxyphenyl group. The compound has a specific stereochemistry, denoted by the R-(R*,R*) designation, indicating the absolute configuration of its chiral centers. (E)-1,4,5,6-tetrahydro-2-[2-(3-hydroxyphenyl)vinyl]-1-methylpyrimidine-1,3-diylium [R-(R*,R*)]-tartrate has potential applications in pharmaceuticals, as it may exhibit biological activity or therapeutic effects due to its specific chemical structure. Further research and testing may be needed to determine the specific properties and potential uses of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 71865-30-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,8,6 and 5 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 71865-30:
(7*7)+(6*1)+(5*8)+(4*6)+(3*5)+(2*3)+(1*0)=140
140 % 10 = 0
So 71865-30-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H13N2O.C4H6O6/c1-15-9-3-8-14-13(15)7-6-11-4-2-5-12(16)10-11;5-1(3(7)8)2(6)4(9)10/h2,4-10H,3H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/q+1;/p-1/b7-6+;/t;1-,2?/m.1/s1
