71889-72-0 Usage
Uses
Used in Pharmaceutical Applications:
6-amidinoindole is used as a potential anticancer agent for its ability to target and inhibit the growth of cancer cells. It has been investigated for its potential to inhibit specific enzymes that play a role in cancer development and progression.
Used in Medicinal Chemistry:
6-amidinoindole is used as a compound in the development of new drugs for various medical conditions due to its unique structure and properties, which may offer novel therapeutic approaches.
Used in Materials Science:
6-amidinoindole is used for its photophysical properties, which have potential applications in the development of new materials with specific optical or electronic characteristics.
Used in Enzyme Inhibition:
6-amidinoindole is used as an enzyme inhibitor, targeting specific enzymes that may contribute to disease processes, thereby offering a therapeutic strategy for intervention.
Used in Drug Development:
6-amidinoindole is used in the research and development of new pharmaceuticals, leveraging its unique chemical properties to create innovative treatments for a range of medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 71889-72-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,8,8 and 9 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 71889-72:
(7*7)+(6*1)+(5*8)+(4*8)+(3*9)+(2*7)+(1*2)=170
170 % 10 = 0
So 71889-72-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3/c10-9(11)7-2-1-6-3-4-12-8(6)5-7/h1-5,12H,(H3,10,11)
