7192-63-4 Usage
Uses
Used in Organic Synthesis:
4-(Allyloxy)-3,5-dipropylbenzamide is used as a building block in organic synthesis for constructing more complex molecules, leveraging its unique structure and functional groups to facilitate the formation of various chemical entities.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-(Allyloxy)-3,5-dipropylbenzamide is used as a starting material for the development of new drug molecules, contributing to the advancement of medicinal chemistry and the creation of innovative therapeutic agents.
Used in Materials Science:
4-(Allyloxy)-3,5-dipropylbenzamide may also find applications in materials science, potentially contributing to the development of new materials with specific properties due to its structural characteristics and chemical reactivity.
Used in Agrochemicals:
4-(Allyloxy)-3,5-dipropylbenzamide may have potential uses in the agrochemicals field, where it could be employed in the development of new pesticides, herbicides, or other agricultural chemicals, enhancing crop protection and yield.
Overall, 4-(Allyloxy)-3,5-dipropylbenzamide is a significant component in chemical research and development, with diverse applications across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 7192-63-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,1,9 and 2 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 7192-63:
(6*7)+(5*1)+(4*9)+(3*2)+(2*6)+(1*3)=104
104 % 10 = 4
So 7192-63-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H23NO2/c1-6-7-19-15-13(10(2)3)8-12(16(17)18)9-14(15)11(4)5/h6,8-11H,1,7H2,2-5H3,(H2,17,18)
