71933-03-4 Usage
Uses
Used in Pharmaceutical Research and Development:
Methyl 5-bromo-2-hydroxypyrimidine-4-carboxylate is used as a key intermediate in the synthesis of biologically active molecules and drug candidates. Its unique structure and reactivity contribute to the development of new pharmaceuticals with potential therapeutic applications.
Used in Agrochemicals:
Methyl 5-bromo-2-hydroxypyrimidine-4-carboxylate may have potential applications in the field of agrochemicals, where it can be utilized as a building block for the development of new agrochemical compounds with improved properties and efficacy.
Used in Materials Science:
In the field of materials science, Methyl 5-bromo-2-hydroxypyrimidine-4-carboxylate may find use in the synthesis of novel materials with specific properties, such as high thermal stability, chemical resistance, or other desirable characteristics.
Overall, Methyl 5-bromo-2-hydroxypyrimidine-4-carboxylate is a versatile and valuable chemical compound with various potential applications in the chemical and pharmaceutical industries, as well as in agrochemicals and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 71933-03-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,9,3 and 3 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 71933-03:
(7*7)+(6*1)+(5*9)+(4*3)+(3*3)+(2*0)+(1*3)=124
124 % 10 = 4
So 71933-03-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BrN2O3/c1-12-5(10)4-3(7)2-8-6(11)9-4/h2H,1H3,(H,8,9,11)
