71953-77-0 Usage
General Description
Leiocarposide is a naturally occurring chemical compound found in various plants, including the fruits of Ugni molinae and the leaves of Olea europaea. It belongs to a class of compounds known as iridoids, which are known for their diverse biological activities. Studies have demonstrated that leiocarposide possesses antioxidant and anti-inflammatory properties, as well as potential anti-diabetic and neuroprotective effects. LEIOCARPOSIDE has also shown promise in the treatment of various diseases, such as cardiovascular conditions and metabolic disorders. Overall, leiocarposide is a valuable chemical that has potential therapeutic applications in various fields of medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 71953-77-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,9,5 and 3 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 71953-77:
(7*7)+(6*1)+(5*9)+(4*5)+(3*3)+(2*7)+(1*7)=150
150 % 10 = 0
So 71953-77-0 is a valid CAS Registry Number.
InChI:InChI=1/C27H34O16/c1-38-24-14(41-27-23(36)21(34)19(32)16(9-29)43-27)7-6-12(30)17(24)25(37)39-10-11-4-2-3-5-13(11)40-26-22(35)20(33)18(31)15(8-28)42-26/h2-7,15-16,18-23,26-36H,8-10H2,1H3/t15-,16-,18-,19-,20+,21+,22-,23-,26-,27-/m1/s1