71975-60-5 Usage
Uses
Used in Pharmaceutical Industry:
Trifluoro-10H-phenothiazine is used as a building block for the synthesis of various pharmaceuticals due to its enhanced reactivity and potential for improved biological activity. Its anti-inflammatory, antimicrobial, and anti-cancer properties make it a valuable compound for the development of new drugs with therapeutic benefits.
Used in Agrochemical Industry:
In the agrochemical industry, trifluoro-10H-phenothiazine is utilized as a building block for the synthesis of agrochemicals, leveraging its enhanced reactivity and potential biological activity to create novel compounds with applications in agriculture.
Used in Drug Development:
Trifluoro-10H-phenothiazine is used as a compound of interest in drug development efforts, given its potential anti-inflammatory, antimicrobial, and anti-cancer properties. Its unique structure and fluorinated nature make it a promising candidate for the creation of new therapeutic agents.
Used in Synthesis of Novel Compounds:
As a versatile building block, trifluoro-10H-phenothiazine is used in the synthesis of novel compounds with potential therapeutic benefits. Its enhanced reactivity and fluorinated nature contribute to the development of innovative pharmaceuticals and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 71975-60-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,9,7 and 5 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 71975-60:
(7*7)+(6*1)+(5*9)+(4*7)+(3*5)+(2*6)+(1*0)=155
155 % 10 = 5
So 71975-60-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H6F3NS/c13-6-5-9-12(11(15)10(6)14)16-7-3-1-2-4-8(7)17-9/h1-5,16H
