7207-40-1 Usage
Amide derivative
3-hydroxy-4-methylaniline The compound is derived from 3-hydroxy-4-methylaniline, which is a type of aromatic amine, by incorporating an amide functional group.
Pharmaceutical and medicinal chemistry research
Common use The compound is frequently used in the research and development of pharmaceuticals and medicinal chemistry due to its potential therapeutic properties.
Analgesic properties
Pain relief 2-[(3-hydroxy-4-methylphenyl)amino]acetamide is known to possess analgesic properties, meaning it can help alleviate pain.
Anti-inflammatory properties
Reducing inflammation The compound also has anti-inflammatory properties, which can help in reducing inflammation in the body.
Potential treatment
Various medical conditions The compound has been studied for its potential use in treating a range of medical conditions, particularly those involving pain and inflammation.
Intermediate for synthesis
Organic compounds 2-[(3-hydroxy-4-methylphenyl)amino]acetamide is used as an intermediate in the synthesis of other organic compounds, making it a valuable building block for creating new drugs and chemical substances.
Compound structure
Acetamide group and 3-hydroxy-4-methylphenylamine group The structure of the compound consists of an acetamide group (a carbonyl group bonded to a nitrogen atom and a hydrogen atom) attached to a 3-hydroxy-4-methylphenylamine group (an aromatic amine with a hydroxyl and a methyl group).
Check Digit Verification of cas no
The CAS Registry Mumber 7207-40-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,2,0 and 7 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 7207-40:
(6*7)+(5*2)+(4*0)+(3*7)+(2*4)+(1*0)=81
81 % 10 = 1
So 7207-40-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2O2/c1-6-2-3-7(4-8(6)12)11-5-9(10)13/h2-4,11-12H,5H2,1H3,(H2,10,13)
