720706-28-5 Usage
Uses
Used in Pharmaceutical Industry:
(5-METHYL-2H-[1,2,4]TRIAZOL-3-YL)-ACETIC ACID is used as a key intermediate in the synthesis of pharmaceutical compounds for its ability to form stable and bioactive molecules. Its presence in the molecular structure can enhance the drug's efficacy, stability, and pharmacokinetic properties.
Used in Agrochemical Industry:
In the agrochemical industry, (5-METHYL-2H-[1,2,4]TRIAZOL-3-YL)-ACETIC ACID is used as a building block for the development of novel agrochemicals, such as pesticides and herbicides. Its incorporation into these compounds can lead to improved performance, selectivity, and environmental compatibility.
Used in Material Science:
(5-METHYL-2H-[1,2,4]TRIAZOL-3-YL)-ACETIC ACID is utilized in the synthesis of advanced materials, such as polymers and coatings, due to its ability to form stable and functionalized structures. Its use in material science can contribute to the development of innovative materials with improved properties and applications.
Used in Research and Development:
As a versatile building block, (5-METHYL-2H-[1,2,4]TRIAZOL-3-YL)-ACETIC ACID is widely used in research and development for the exploration of new chemical reactions, synthesis methods, and potential applications across various fields. Its unique structure and reactivity make it an attractive candidate for scientific investigation and innovation.
Check Digit Verification of cas no
The CAS Registry Mumber 720706-28-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,2,0,7,0 and 6 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 720706-28:
(8*7)+(7*2)+(6*0)+(5*7)+(4*0)+(3*6)+(2*2)+(1*8)=135
135 % 10 = 5
So 720706-28-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H7N3O2/c1-3-6-4(8-7-3)2-5(9)10/h2H2,1H3,(H,9,10)(H,6,7,8)
