72091-25-9 Usage
Class
Pyrimidine (a type of heterocyclic organic compound)
Contains
Two amino groups (-NH2) and one imino group (-N=)
Molecular structure
A pyrimidine ring with two nitrogen atoms and one oxygen atom
Importance
Building block in the synthesis of various drugs, agrochemicals, and materials
Pharmaceutical applications
Potential use in anti-cancer and anti-inflammatory drug development
Chemical reactivity
Unique chemical reactivity and structural properties, used as a precursor in the synthesis of various chemical compounds and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 72091-25-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,0,9 and 1 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 72091-25:
(7*7)+(6*2)+(5*0)+(4*9)+(3*1)+(2*2)+(1*5)=109
109 % 10 = 9
So 72091-25-9 is a valid CAS Registry Number.
InChI:InChI=1/C4H5N5O/c5-1-2(6)8-4(7)9-3(1)10/h5H,(H4,6,7,8,9,10)/b5-1-
