72142-88-2 Usage
Uses
Used in Organic Synthesis:
DIMETHYL-D6-CYANAMIDE is used as a synthetic building block for the development of a wide range of organic compounds. Its unique chemical structure allows it to be a versatile component in the synthesis of various molecules, making it a valuable asset in the field of organic chemistry.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, DIMETHYL-D6-CYANAMIDE is used as an intermediate in the synthesis of various pharmaceutical compounds. Its ability to be incorporated into complex molecular structures makes it a useful tool in the development of new drugs and medications.
Used in Chemical Research:
DIMETHYL-D6-CYANAMIDE is also employed in chemical research as a reagent for studying the properties and reactions of different organic compounds. Its clear, colorless oil form makes it an ideal candidate for use in laboratory settings, where it can be easily manipulated and observed during experiments.
Used in Material Science:
In the field of material science, DIMETHYL-D6-CYANAMIDE is used as a component in the development of new materials with specific properties. Its inclusion in the synthesis process can lead to the creation of materials with unique characteristics, such as improved stability or enhanced reactivity.
Overall, DIMETHYL-D6-CYANAMIDE is a versatile compound with a wide range of applications across various industries, including organic synthesis, pharmaceuticals, chemical research, and material science. Its unique properties and ability to be incorporated into a variety of molecular structures make it a valuable asset in the development of new compounds and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 72142-88-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,1,4 and 2 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 72142-88:
(7*7)+(6*2)+(5*1)+(4*4)+(3*2)+(2*8)+(1*8)=112
112 % 10 = 2
So 72142-88-2 is a valid CAS Registry Number.
InChI:InChI=1/C3H6N2/c1-5(2)3-4/h1-2H3/i1D3,2D3
