72175-33-8 Usage
Uses
Used in Organic Synthesis:
Methyl 3-bicyclo[2.2.1]hept-5-en-2-yl-3-methyloxirane-2-carboxylate is used as a key intermediate in organic synthesis for its unique molecular structure and reactivity, allowing for the creation of novel compounds with specific properties.
Used in Medicinal Chemistry:
In the pharmaceutical industry, methyl 3-bicyclo[2.2.1]hept-5-en-2-yl-3-methyloxirane-2-carboxylate is used as a building block in the development of new drugs, potentially contributing to the synthesis of bioactive molecules with therapeutic applications.
Used in Industrial Processes:
Methyl 3-bicyclo[2.2.1]hept-5-en-2-yl-3-methyloxirane-2-carboxylate may be utilized in various industrial processes due to its specific chemical properties, such as in the production of specialty chemicals, materials, or as a component in advanced formulations.
Check Digit Verification of cas no
The CAS Registry Mumber 72175-33-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,1,7 and 5 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 72175-33:
(7*7)+(6*2)+(5*1)+(4*7)+(3*5)+(2*3)+(1*3)=118
118 % 10 = 8
So 72175-33-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H16O3/c1-12(10(15-12)11(13)14-2)9-6-7-3-4-8(9)5-7/h3-4,7-10H,5-6H2,1-2H3
