72175-33-8 Usage
General Description
Methyl 3-bicyclo[2.2.1]hept-5-en-2-yl-3-methyloxirane-2-carboxylate is a chemical compound with a complex and specific molecular structure. It consists of a methyl ester group attached to a bicyclic ring system, which includes a cyclopentene ring fused to a cyclopropane ring. The presence of an oxirane moiety in the molecule indicates the presence of an epoxide functional group. methyl 3-bicyclo[2.2.1]hept-5-en-2-yl-3-methyloxirane-2-carboxylate is likely to possess unique chemical and physical properties due to its intricate structure, and it may have potential applications in organic synthesis, medicinal chemistry, or other industrial processes. Further research and analysis are necessary to fully understand the behavior and potential uses of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 72175-33-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,1,7 and 5 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 72175-33:
(7*7)+(6*2)+(5*1)+(4*7)+(3*5)+(2*3)+(1*3)=118
118 % 10 = 8
So 72175-33-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H16O3/c1-12(10(15-12)11(13)14-2)9-6-7-3-4-8(9)5-7/h3-4,7-10H,5-6H2,1-2H3
