72252-96-1 Usage
Description
N-succinimidyl-4-((iodoacetyl)amino)benzoate is a heterobifunctional protein crosslinking reagent that contains both sulfhydryl and amino reactive groups. It is characterized by a spacer arm of 10.6 angstroms, which allows for the efficient and specific conjugation of proteins through the formation of stable covalent bonds.
Uses
Used in Biochemistry Research:
N-succinimidyl-4-((iodoacetyl)amino)benzoate is used as a protein crosslinking agent for the study of protein-protein interactions, protein structure, and function in biochemical research. Its sulfhydryl and amino reactive groups enable the specific labeling and modification of proteins, facilitating the investigation of their properties and interactions.
Used in Drug Development:
N-succinimidyl-4-((iodoacetyl)amino)benzoate is used as a protein conjugation reagent in the development of novel therapeutic agents. Its ability to form stable covalent bonds with proteins allows for the creation of targeted drug delivery systems, improving the efficacy and specificity of drug treatments.
Used in Diagnostic Applications:
N-succinimidyl-4-((iodoacetyl)amino)benzoate is used as a protein labeling agent in the development of diagnostic tools and assays. Its reactive groups enable the attachment of reporter molecules, such as fluorescent dyes or enzymes, to proteins, allowing for the sensitive and specific detection of target proteins in biological samples.
Used in Materials Science:
N-succinimidyl-4-((iodoacetyl)amino)benzoate is used as a protein immobilization reagent in the fabrication of biomaterials and biosensors. Its ability to form stable covalent bonds with proteins allows for the attachment of biologically active molecules to various surfaces, enabling the development of advanced materials with specific functions and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 72252-96-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,2,5 and 2 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 72252-96:
(7*7)+(6*2)+(5*2)+(4*5)+(3*2)+(2*9)+(1*6)=121
121 % 10 = 1
So 72252-96-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H11IN2O5/c14-6-10(17)15-7-1-2-8(13(20)21)9(5-7)16-11(18)3-4-12(16)19/h1-2,5H,3-4,6H2,(H,15,17)(H,20,21)/p-1