72263-05-9 Usage
Uses
Used in Pharmaceutical Industry:
Conglobatin is used as an anticancer agent for its ability to exhibit anticancer properties, making it a promising candidate for the development of novel cancer therapies.
Additionally, conglobatin is used as an immunosuppressant due to its immunosuppressive effects, which can be beneficial in managing autoimmune diseases and preventing transplant rejections.
Check Digit Verification of cas no
The CAS Registry Mumber 72263-05-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,2,6 and 3 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 72263-05:
(7*7)+(6*2)+(5*2)+(4*6)+(3*3)+(2*0)+(1*5)=109
109 % 10 = 9
So 72263-05-9 is a valid CAS Registry Number.
InChI:InChI=1/C28H38N2O6/c1-17-7-19(3)25(11-23-13-29-15-33-23)35-28(32)22(6)10-18(2)8-20(4)26(12-24-14-30-16-34-24)36-27(31)21(5)9-17/h9-10,13-20,25-26H,7-8,11-12H2,1-6H3/b21-9-,22-10+/t17-,18-,19+,20+,25+,26+/m1/s1