72282-75-8 Usage
Explanation
The molecular formula represents the number of atoms of each element present in a molecule. In this case, the compound has 11 carbon (C) atoms, 16 hydrogen (H) atoms, and 2 nitrogen (N) atoms.
2. Heterocyclic Compound
Explanation
A heterocyclic compound is a cyclic compound that contains atoms of at least two different elements, in this case, carbon, hydrogen, and nitrogen.
3. Pyridazine Ring
Explanation
The compound contains a pyridazine ring, which is a six-membered nitrogen-containing heterocycle with the formula C4H4N2.
4. Phthalazine Ring
Explanation
The compound also contains a phthalazine ring, which is a fused bicyclic system consisting of a pyridine and a diazine ring, with the formula C8H6N2.
5. Fused Bicyclic Structure
Explanation
The pyridazine and phthalazine rings are fused together, creating a bicyclic structure.
6. Hexahydro Configuration
Explanation
The compound has six hydrogen atoms in the hexahydro configuration, which means that it has six hydrogen atoms attached to the bicyclic structure.
7. Pharmaceutical Research
Explanation
1,4-Ethanopyridazino(1,2-b)phthalazine, 1,2,3,4,6,11-hexahydrois used in pharmaceutical research as a potential drug candidate for various therapeutic applications.
8. Unique Structure
Explanation
The compound's unique structure, with its fused bicyclic system and hexahydro configuration, contributes to its potential biological activity and therapeutic applications.
9. Ongoing Research
Explanation
Research on 1,4-Ethanopyridazino(1,2-b)phthalazine, 1,2,3,4,6,11-hexahydro- is ongoing to further understand its potential uses and properties, as well as to explore its potential as a drug candidate for various therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 72282-75-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,2,8 and 2 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 72282-75:
(7*7)+(6*2)+(5*2)+(4*8)+(3*2)+(2*7)+(1*5)=128
128 % 10 = 8
So 72282-75-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H18N2/c1-2-4-12-10-16-14-7-5-13(6-8-14)15(16)9-11(12)3-1/h1-4,13-14H,5-10H2
