723281-53-6 Usage
General Description
3-(Pyrrolidine-1-carbonyl)phenylboronic acid is a chemical compound with the molecular formula C12H15BCNO3. It is commonly used in organic chemistry as a precursor in the synthesis of various pharmaceuticals and agrochemicals. 3-(Pyrrolidine-1-carbonyl)phenylboronic acid is an important tool in the field of medicinal chemistry, as it can be used in the development of new drugs and pharmaceutical products. It is also used as a building block in the synthesis of various biologically active molecules, making it a valuable tool in drug discovery and development. Additionally, 3-(Pyrrolidine-1-carbonyl)phenylboronic acid has been studied for its potential anti-inflammatory and antiviral properties, further highlighting its importance in the field of medicinal chemistry and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 723281-53-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,2,3,2,8 and 1 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 723281-53:
(8*7)+(7*2)+(6*3)+(5*2)+(4*8)+(3*1)+(2*5)+(1*3)=146
146 % 10 = 6
So 723281-53-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H14BNO3/c14-11(13-6-1-2-7-13)9-4-3-5-10(8-9)12(15)16/h3-5,8,15-16H,1-2,6-7H2
