723284-83-1 Usage
General Description
(S)-3-Amino-3-(3,4-methylenedioxyphenyl)propionic acid is a chemical compound with the molecular formula C11H13NO4. It is a derivative of the amino acid phenylalanine, which is an essential amino acid that is important for the synthesis of proteins in the body. (S)-3-AMINO-3-(3,4-METHYLENEDIOXYPHENYL)PROPIONIC ACID is also known as MDPHPA and is a potential intermediate in the synthesis of pharmaceuticals and other organic compounds. It has been studied for its potential medicinal properties, including as a potential anti-inflammatory and analgesic agent. Additionally, it may have potential applications in the field of organic chemistry and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 723284-83-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,2,3,2,8 and 4 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 723284-83:
(8*7)+(7*2)+(6*3)+(5*2)+(4*8)+(3*4)+(2*8)+(1*3)=161
161 % 10 = 1
So 723284-83-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO4/c11-7(4-10(12)13)6-1-2-8-9(3-6)15-5-14-8/h1-3,7H,4-5,11H2,(H,12,13)/t7-/m0/s1