723284-83-1 Usage
Uses
Used in Pharmaceutical Industry:
(S)-3-AMINO-3-(3,4-METHYLENEDIOXYPHENYL)PROPIONIC ACID is used as a potential intermediate in the synthesis of pharmaceuticals for its potential medicinal properties. Its ability to act as an anti-inflammatory and analgesic agent makes it a valuable compound in the development of new medications to treat pain and inflammation.
Used in Organic Chemistry:
In the field of organic chemistry, (S)-3-AMINO-3-(3,4-METHYLENEDIOXYPHENYL)PROPIONIC ACID is used as a building block for the synthesis of various organic compounds. Its unique structure and functional groups allow chemists to explore its reactivity and potential applications in creating new molecules with desired properties.
Used in Drug Development:
(S)-3-AMINO-3-(3,4-METHYLENEDIOXYPHENYL)PROPIONIC ACID is utilized in drug development as a potential lead compound for the discovery of new therapeutic agents. Its medicinal properties and potential applications in treating pain and inflammation make it an attractive candidate for further research and development to create novel drugs with improved efficacy and safety profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 723284-83-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,2,3,2,8 and 4 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 723284-83:
(8*7)+(7*2)+(6*3)+(5*2)+(4*8)+(3*4)+(2*8)+(1*3)=161
161 % 10 = 1
So 723284-83-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO4/c11-7(4-10(12)13)6-1-2-8-9(3-6)15-5-14-8/h1-3,7H,4-5,11H2,(H,12,13)/t7-/m0/s1
