7236-47-7 Usage
General Description
3-Benzal-N-butyramide is a chemical compound that belongs to the class of amides, which are organic compounds containing a carbonyl group bonded to a nitrogen atom. It is derived from benzaldehyde and butyramide, and is commonly used as a precursor in the synthesis of various pharmaceuticals and organic compounds. This chemical is also known for its potential antioxidant and anti-inflammatory properties, making it a potential candidate for the development of new drugs or therapeutic agents. Additionally, 3-Benzal-N-butyramide has been studied for its potential neuroprotective effects, suggesting that it may have applications in the treatment of neurodegenerative diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 7236-47-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,2,3 and 6 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 7236-47:
(6*7)+(5*2)+(4*3)+(3*6)+(2*4)+(1*7)=97
97 % 10 = 7
So 7236-47-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H13NO/c1-9(8-11(12)13)7-10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H2,12,13)/b9-7+
