72403-05-5 Usage
Uses
Used in Pharmaceutical Applications:
7-Chloro-2H-benzo[b][1,4]oxazin-3(4H)-one is used as a pharmaceutical agent for its anti-cancer properties, targeting various types of cancer cells. Its anti-inflammatory and anti-bacterial activities also contribute to its potential use in developing treatments for inflammatory and infectious diseases.
Used in Agrochemical Applications:
In the agrochemical industry, 7-Chloro-2H-benzo[b][1,4]oxazin-3(4H)-one is used as a bioactive compound for its anti-bacterial properties, making it a potential candidate for developing new pesticides or fungicides to protect crops from bacterial infections and other related threats.
Used in Organic Synthesis:
7-Chloro-2H-benzo[b][1,4]oxazin-3(4H)-one is used as a building block in organic synthesis for creating more complex organic molecules. Its unique structure allows for the development of new compounds with potential applications in various fields, including pharmaceuticals, materials science, and agrochemicals.
Used in Drug Discovery and Development:
Due to its heterocyclic nature and diverse biological activities, 7-Chloro-2H-benzo[b][1,4]oxazin-3(4H)-one is used in drug discovery and development processes. Researchers can utilize 7-Chloro-2H-benzo[b][1,4]oxazin-3(4H)-one as a starting point for designing new drugs with improved efficacy and selectivity for various therapeutic targets.
Check Digit Verification of cas no
The CAS Registry Mumber 72403-05-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,4,0 and 3 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 72403-05:
(7*7)+(6*2)+(5*4)+(4*0)+(3*3)+(2*0)+(1*5)=95
95 % 10 = 5
So 72403-05-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClNO2/c9-5-1-2-6-7(3-5)12-4-8(11)10-6/h1-3H,4H2,(H,10,11)