72491-44-2 Usage
Molecular structure
The compound has a complex molecular structure, featuring a quinolinium core with an ethyl group and a propenyl group attached to it.
Benzene ring
It contains a benzene ring, which is a stable, planar ring of six carbon atoms bonded to each other through alternating single and double bonds.
Selenium and iodine atoms
The presence of a selenium and iodine atom in the compound suggests that it may have unique chemical and biological properties.
Quinolinium salt
The compound is classified as a quinolinium salt, which is a group of chemical compounds that includes many pharmaceuticals, such as antibiotics and antimalarial drugs.
Biological activities
Due to the presence of selenium and quinolinium moieties, the compound may exhibit potential biological activities, though further research is needed to confirm this.
Chemical and pharmaceutical applications
The compound could have potential uses in various chemical and pharmaceutical applications, but its specific properties and applications would require further investigation.
Ethyl and propenyl groups
The presence of an ethyl group (a two-carbon chain with a hydrogen atom and a methyl group) and a propenyl group (a three-carbon chain with a hydrogen atom, a methyl group, and a double bond) in the molecular structure may contribute to its chemical reactivity and potential applications.
3H-benzoselenazol-2-ylidene group
The presence of a 3H-benzoselenazol-2-ylidene group (a selenium-containing heterocyclic ring fused to a benzene ring) may contribute to the compound's unique properties and potential applications.
Iodide salt
The iodide salt form of the compound suggests that it may be soluble in water and could be used in various chemical reactions and applications.
Further research needed
The specific properties, potential uses, and biological activities of 1-ethyl-2-[3-(3-ethyl-3H-benzoselenazol-2-ylidene)prop-1-enyl]quinolinium iodide require further research and investigation to be fully understood and explored.
Check Digit Verification of cas no
The CAS Registry Mumber 72491-44-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,4,9 and 1 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 72491-44:
(7*7)+(6*2)+(5*4)+(4*9)+(3*1)+(2*4)+(1*4)=132
132 % 10 = 2
So 72491-44-2 is a valid CAS Registry Number.
InChI:InChI=1/C23H23N2Se.HI/c1-3-24-19(17-16-18-10-5-6-12-20(18)24)11-9-15-23-25(4-2)21-13-7-8-14-22(21)26-23;/h5-17H,3-4H2,1-2H3;1H/q+1;/p-1