7254-01-5 Usage
Explanation
The molecular formula represents the number of atoms of each element present in a molecule. In this case, the compound has 2 carbon (C), 4 hydrogen (H), 6 nitrogen (N), and 1 sulfur (S) atoms.
Explanation
This structure consists of a thiadiazole ring fused with a carboximidic acid group at position 3, an amino group at position 4, and a hydrazide group attached to the amino group.
Explanation
Due to its unique structure and versatile reactivity, 1,2,5-Thiadiazole-3-carboximidic acid, 4-amino-, hydrazide is used as a starting material for creating new drug molecules in the pharmaceutical industry.
Explanation
Studies have shown that 1,2,5-Thiadiazole-3-carboximidic acid, 4-amino-, hydrazide exhibits potential antibacterial and antifungal activities, making it a promising candidate for the development of treatments for infectious diseases.
Explanation
The compound's structure and reactivity allow for the creation of new bioactive molecules with potential therapeutic applications in medicine.
Explanation
As a chemically important compound, 1,2,5-Thiadiazole-3-carboximidic acid, 4-amino-, hydrazide serves as a key building block for the synthesis of various bioactive molecules with potential applications in the medical field.
Chemical Structure
1,2,5-Thiadiazole-3-carboximidic acid, 4-amino-, hydrazide
Pharmaceutical Industry Application
Building block for synthesis of potential drug candidates
Biological Activities
Antibacterial and antifungal properties
Potential Medicinal Applications
Development of novel bioactive molecules
Chemical Importance
Valuable precursor in the development of bioactive molecules
Check Digit Verification of cas no
The CAS Registry Mumber 7254-01-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,2,5 and 4 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 7254-01:
(6*7)+(5*2)+(4*5)+(3*4)+(2*0)+(1*1)=85
85 % 10 = 5
So 7254-01-5 is a valid CAS Registry Number.
InChI:InChI=1/C3H6N6S/c4-2(7-6)1-3(5)9-10-8-1/h6H2,(H2,4,7)(H2,5,9)
