72719-97-2 Usage
Uses
Used in Organic Synthesis:
(2R)-2-[(S)-3-Bromopropadien-1-yl]-5β-[(S)-1-bromopropyl]-3,3aβ,5,6,9,9aβ-hexahydro-2H-furo[3,2-b]oxocin is utilized as a key intermediate in organic synthesis for the development of novel compounds with potential applications in various industries. Its unique structural features, including the furan ring and bromine atoms, allow for versatile chemical reactions and the creation of new molecular entities.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, (2R)-2-[(S)-3-Bromopropadien-1-yl]-5β-[(S)-1-bromopropyl]-3,3aβ,5,6,9,9aβ-hexahydro-2H-furo[3,2-b]oxocin serves as a valuable building block for the design and synthesis of new pharmaceutical agents. Its specific stereochemistry and functional groups can be exploited to create molecules with desired biological activities, potentially leading to the discovery of new drugs for the treatment of various diseases.
Used in Chemical Research:
(2R)-2-[(S)-3-Bromopropadien-1-yl]-5β-[(S)-1-bromopropyl]-3,3aβ,5,6,9,9aβ-hexahydro-2H-furo[3,2-b]oxocin is also employed in chemical research to study the properties and reactivity of complex organic molecules. Its unique structure provides an opportunity for scientists to explore new reaction pathways, mechanisms, and the influence of stereochemistry on molecular behavior, contributing to the advancement of chemical knowledge and innovation.
Check Digit Verification of cas no
The CAS Registry Mumber 72719-97-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,7,1 and 9 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 72719-97:
(7*7)+(6*2)+(5*7)+(4*1)+(3*9)+(2*9)+(1*7)=152
152 % 10 = 2
So 72719-97-2 is a valid CAS Registry Number.
InChI:InChI=1/C15H20Br2O2/c1-2-12(17)13-7-3-4-8-14-15(19-13)10-11(18-14)6-5-9-16/h3-4,6,9,11-15H,2,7-8,10H2,1H3/b4-3-
