72725-98-5 Usage
Uses
Used in Chemical Synthesis:
3-Chloro-2,6-Dimethylaniline Hydrochloride is used as a reagent in chemical synthesis for its unique reaction properties. It is particularly valuable in the preparation of various organic compounds and intermediates, contributing to the development of new materials and pharmaceuticals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-Chloro-2,6-Dimethylaniline Hydrochloride is used as an intermediate in the synthesis of certain drugs. Its specific functional groups and reactivity make it a key component in the production of medicinal compounds, potentially leading to the development of new therapeutic agents.
Used in Dye and Pigment Production:
3-Chloro-2,6-Dimethylaniline Hydrochloride is also utilized in the production of dyes and pigments. Its chemical structure lends itself to the creation of a range of colors, making it a valuable component in the formulation of various colorants for industrial applications.
Used in Research and Development:
In research and development settings, 3-Chloro-2,6-Dimethylaniline Hydrochloride serves as a model compound for studying chemical reactions and mechanisms. Its unique properties allow scientists to explore new reaction pathways and develop innovative synthetic strategies, furthering the understanding of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 72725-98-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,7,2 and 5 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 72725-98:
(7*7)+(6*2)+(5*7)+(4*2)+(3*5)+(2*9)+(1*8)=145
145 % 10 = 5
So 72725-98-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H10ClN.ClH/c1-5-3-4-7(9)6(2)8(5)10;/h3-4H,10H2,1-2H3;1H
72725-98-5Relevant academic research and scientific papers
Synthesis and Reactions of Derivatives of 6-Imino-2,4-cyclohexadien-1-ols
Stahl, Mark A.,Kenesky, Bernadine F.,Berbee, Robertus P. M.,Richards, Matthew,Heine, Harold W.
, p. 1197 - 1202 (2007/10/02)
α-(p-Nitrophenyl)-N-(2,6-dimethylphenyl)nitrone (6a) and α-(p-nitrophenyl)-N-(2,4,6-trimethylphenyl)nitrone (6b) are isomerized by p-nitrobenzoyl chloride in anhydrous ether into N-(2,6-dimethylphenyl)-p-nitrobenzamide (7a) and N-(2,4,6-trimethylphenyl)-p
