72748-85-7 Usage
Derivative of benzimidazole
A heterocyclic compound containing a benzene ring fused to an imidazole ring This shows that the compound is derived from the parent molecule benzimidazole, which consists of two fused rings (a benzene ring and an imidazole ring).
Saturated ring system
Resulting from the addition of hydrogen atoms The presence of four hydrogen atoms in the structure leads to a saturated ring system, which means that all the carbon atoms in the rings are fully bonded with hydrogen atoms.
Used in organic synthesis and pharmaceutical research
Potential applications in the development of new drugs and biologically active molecules This highlights the compound's importance in the field of chemistry and medicine, as it can be used to create new drugs and molecules with potential biological activity.
Versatility in scientific and industrial applications
Due to its molecular structure and properties The compound's structure and properties make it suitable for various chemical reactions and interactions, contributing to its wide range of applications in both scientific research and industrial processes.
Check Digit Verification of cas no
The CAS Registry Mumber 72748-85-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,7,4 and 8 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 72748-85:
(7*7)+(6*2)+(5*7)+(4*4)+(3*8)+(2*8)+(1*5)=157
157 % 10 = 7
So 72748-85-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H11N3/c8-5-1-2-6-7(3-5)10-4-9-6/h4-5H,1-3,8H2,(H,9,10)
