72754-04-2 Usage
Uses
Used in Medicinal Chemistry and Drug Discovery:
2,6-dibromo-1,8-naphthyridine is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure and properties make it a promising candidate for the development of new drugs with antibacterial and antifungal properties.
Used in Synthesis of Other Organic Compounds:
2,6-dibromo-1,8-naphthyridine serves as a building block in the creation of new materials and organic compounds. Its reactivity and structural features allow for the formation of diverse chemical entities with potential applications in various fields.
Used in Biochemistry Research:
2,6-dibromo-1,8-naphthyridine is used as a fluorescent probe in biochemistry research. It aids in studying DNA and RNA interactions, providing valuable insights into the molecular mechanisms underlying various biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 72754-04-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,7,5 and 4 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 72754-04:
(7*7)+(6*2)+(5*7)+(4*5)+(3*4)+(2*0)+(1*4)=132
132 % 10 = 2
So 72754-04-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H4Br2N2/c9-6-3-5-1-2-7(10)12-8(5)11-4-6/h1-4H
72754-04-2Relevant academic research and scientific papers
1, 5-NAPHTHYRIDINE COMPOUND AND ORGANIC LIGHT-EMITTING DEVICE
-
, (2008/12/05)
The present invention provides a novel 1,5-naphthyridine compound represented by the following general formula [I]: wherein R1, R2, R4 and R5 each represent one selected from a hydrogen atom, a substituted or unsubstituted alkyl group, and the like; and R3 and R6 each represent one selected from a substituted or unsubstituted aralkyl group, a substituted or unsubstituted aryl group, and the like.
