72768-95-7 Usage
Uses
Used in Scientific Research:
3-(Difluoromethoxy)benzyl bromide is used as a chemical intermediate for various scientific research applications, contributing to the development of complex chemical compounds and advanced pharmaceuticals.
Used in Pharmaceutical Manufacturing:
3-(Difluoromethoxy)benzyl bromide is used as a key component in the synthesis of advanced pharmaceuticals, therapeutic chemicals, and other high-value added products, due to its reactivity and ability to participate in specific chemical reactions.
Used in Organic Syntheses:
3-(Difluoromethoxy)benzyl bromide is used as a reactive compound in organic syntheses, where its functional groups facilitate targeted chemical reactions, leading to the creation of new and complex molecules.
Used in Controlled Industrial Processes:
3-(Difluoromethoxy)benzyl bromide is used as a specialized chemical intermediate in controlled industrial processes, where its reactivity and functional groups are harnessed to produce high-value chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 72768-95-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,7,6 and 8 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 72768-95:
(7*7)+(6*2)+(5*7)+(4*6)+(3*8)+(2*9)+(1*5)=167
167 % 10 = 7
So 72768-95-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H7BrF2O/c9-5-6-2-1-3-7(4-6)12-8(10)11/h1-4,8H,5H2
